C24H30FNO5S — CID 11431195
(4R,5R)-3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 11431195) has the molecular formula C24H30FNO5S and a molecular weight of 463.57 g/mol. Its IUPAC name is (4R,5R)-3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (4R,5R)-3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 11431195 |
| Molecular Formula | C24H30FNO5S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (4R,5R)-3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(F)cc2[C@@H](c2cccc([N+](=O)[O-])c2)[C@H]1O |
| InChI | InChI=1S/C24H30FNO5S/c1-3-5-12-24(13-6-4-2)16-32(30,31)21-11-10-18(25)15-20(21)22(23(24)27)17-8-7-9-19(14-17)26(28)29/h7-11,14-15,22-23,27H,3-6,12-13,16H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | IXXKOVFYTKXJAU-DHIUTWEWSA-N |
| XLogP | 5.38 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|