C20H20F3N5O3S — CID 11431267
3-[(3-amino-7-methyl-6-thiophen-2-ylpyrrolo[3,2-f]quinazolin-1-yl)amino]propan-1-ol;2,2,2-trifluoroacetic acid (PubChem CID 11431267) has the molecular formula C20H20F3N5O3S and a molecular weight of 467.47 g/mol. Its IUPAC name is 3-[(3-amino-7-methyl-6-thiophen-2-ylpyrrolo[3,2-f]quinazolin-1-yl)amino]propan-1-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(3-amino-7-methyl-6-thiophen-2-ylpyrrolo[3,2-f]quinazolin-1-yl)amino]propan-1-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11431267 |
| Molecular Formula | C20H20F3N5O3S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 3-[(3-amino-7-methyl-6-thiophen-2-ylpyrrolo[3,2-f]quinazolin-1-yl)amino]propan-1-ol;2,2,2-trifluoroacetic acid |
| SMILES | Cn1ccc2c3c(NCCCO)nc(N)nc3cc(-c3cccs3)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19N5OS.C2HF3O2/c1-23-7-5-11-15-13(10-12(16(11)23)14-4-2-9-25-14)21-18(19)22-17(15)20-6-3-8-24;3-2(4,5)1(6)7/h2,4-5,7,9-10,24H,3,6,8H2,1H3,(H3,19,20,21,22);(H,6,7) |
| InChIKey | VPWSVUCZABMPRP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|