C12H15BrFNO — CID 114313529
N-(3-bromo-2-methylpropyl)-2-(4-fluorophenyl)acetamide (PubChem CID 114313529) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is N-(3-bromo-2-methylpropyl)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-(3-bromo-2-methylpropyl)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 114313529 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-(3-bromo-2-methylpropyl)-2-(4-fluorophenyl)acetamide |
| SMILES | CC(CBr)CNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H15BrFNO/c1-9(7-13)8-15-12(16)6-10-2-4-11(14)5-3-10/h2-5,9H,6-8H2,1H3,(H,15,16) |
| InChIKey | UTDIBZMLHFUEDG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|