C17H24BrNO — CID 114314026
N-[1-(bromomethyl)cyclohexyl]-2,4,6-trimethylbenzamide (PubChem CID 114314026) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclohexyl]-2,4,6-trimethylbenzamide.
| Compound Name | N-[1-(bromomethyl)cyclohexyl]-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 114314026 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[1-(bromomethyl)cyclohexyl]-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC2(CBr)CCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H24BrNO/c1-12-9-13(2)15(14(3)10-12)16(20)19-17(11-18)7-5-4-6-8-17/h9-10H,4-8,11H2,1-3H3,(H,19,20) |
| InChIKey | LSKYGQQSQXMGHA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|