About N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide
N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide (PubChem CID 114314148) has the molecular formula C11H17BrF3NO
and a molecular weight of 316.16 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide |
| PubChem CID | 114314148 |
| Molecular Formula | C11H17BrF3NO |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NC1(CBr)CCCCC1 |
| InChI | InChI=1S/C11H17BrF3NO/c12-8-10(5-2-1-3-6-10)16-9(17)4-7-11(13,14)15/h1-8H2,(H,16,17) |
| InChIKey | NCMPDGJPLWTHMJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide?
The IUPAC name of N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide (CID 114314148) is N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide?
The canonical SMILES for N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide is O=C(CCC(F)(F)F)NC1(CBr)CCCCC1.
What is the InChIKey of N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide?
The InChIKey is NCMPDGJPLWTHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrF3NO/c12-8-10(5-2-1-3-6-10)16-9(17)4-7-11(13,14)15/h1-8H2,(H,16,17).
What are the key properties of N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide?
N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide has a molecular weight of 316.16 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(bromomethyl)cyclohexyl]-4,4,4-trifluorobutanamide is sourced from PubChem (CID 114314148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).