C24H16ClN5O2S — CID 11431426
2-(4-chlorophenyl)-3-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one (PubChem CID 11431426) has the molecular formula C24H16ClN5O2S and a molecular weight of 473.95 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one.
| Compound Name | 2-(4-chlorophenyl)-3-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
|---|---|
| PubChem CID | 11431426 |
| Molecular Formula | C24H16ClN5O2S |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2-pyridin-3-yl-1,3-thiazole-4-carbonyl)-3,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-7-one |
| SMILES | O=C(c1csc(-c2cccnc2)n1)N1CCN2C(=O)c3ccncc3C12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16ClN5O2S/c25-17-5-3-16(4-6-17)24-19-13-27-9-7-18(19)22(31)29(24)10-11-30(24)23(32)20-14-33-21(28-20)15-2-1-8-26-12-15/h1-9,12-14H,10-11H2 |
| InChIKey | JBRXCDYHCIGHOB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |