C18H32BrNO — CID 114315007
N-[1-(bromomethyl)-4-methylcyclohexyl]-1-(2-methylpropyl)cyclopentane-1-carboxamide (PubChem CID 114315007) has the molecular formula C18H32BrNO and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[1-(bromomethyl)-4-methylcyclohexyl]-1-(2-methylpropyl)cyclopentane-1-carboxamide.
| Compound Name | N-[1-(bromomethyl)-4-methylcyclohexyl]-1-(2-methylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114315007 |
| Molecular Formula | C18H32BrNO |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[1-(bromomethyl)-4-methylcyclohexyl]-1-(2-methylpropyl)cyclopentane-1-carboxamide |
| SMILES | CC(C)CC1(C(=O)NC2(CBr)CCC(C)CC2)CCCC1 |
| InChI | InChI=1S/C18H32BrNO/c1-14(2)12-17(8-4-5-9-17)16(21)20-18(13-19)10-6-15(3)7-11-18/h14-15H,4-13H2,1-3H3,(H,20,21) |
| InChIKey | FMWIFYSFTKWLKM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|