C12H22BrNO — CID 114315142
N-[3-(bromomethyl)pentan-3-yl]cyclopentanecarboxamide (PubChem CID 114315142) has the molecular formula C12H22BrNO and a molecular weight of 276.22 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]cyclopentanecarboxamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 114315142 |
| Molecular Formula | C12H22BrNO |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]cyclopentanecarboxamide |
| SMILES | CCC(CC)(CBr)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C12H22BrNO/c1-3-12(4-2,9-13)14-11(15)10-7-5-6-8-10/h10H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | FIJUWFLSIBHJSF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|