About N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide
N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide (PubChem CID 114315150) has the molecular formula C16H24BrNO
and a molecular weight of 326.28 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide.
Molecular Properties
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide |
| PubChem CID | 114315150 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide |
| SMILES | CCC(CC)(CBr)NC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H24BrNO/c1-6-16(7-2,10-17)18-15(19)14-12(4)8-11(3)9-13(14)5/h8-9H,6-7,10H2,1-5H3,(H,18,19) |
| InChIKey | KNQDLDGCKSIVIM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide?
The IUPAC name of N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide (CID 114315150) is N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide.
What is the SMILES notation for N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide?
The canonical SMILES for N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide is CCC(CC)(CBr)NC(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide?
The InChIKey is KNQDLDGCKSIVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BrNO/c1-6-16(7-2,10-17)18-15(19)14-12(4)8-11(3)9-13(14)5/h8-9H,6-7,10H2,1-5H3,(H,18,19).
What are the key properties of N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide?
N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide has a molecular weight of 326.28 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(bromomethyl)pentan-3-yl]-2,4,6-trimethylbenzamide is sourced from PubChem (CID 114315150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).