About diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide
diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide (PubChem CID 11431545) has the molecular formula C26H28BrN2P
and a molecular weight of 479.40 g/mol. Its IUPAC name is diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide.
Molecular Properties
| Compound Name | diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide |
| PubChem CID | 11431545 |
| Molecular Formula | C26H28BrN2P |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide |
| SMILES | Cc1cc(C)c(-n2cc[n+](CCP(c3ccccc3)c3ccccc3)c2)c(C)c1.[Br-] |
| InChI | InChI=1S/C26H28N2P.BrH/c1-21-18-22(2)26(23(3)19-21)28-15-14-27(20-28)16-17-29(24-10-6-4-7-11-24)25-12-8-5-9-13-25;/h4-15,18-20H,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RHONJOMFWFUXCG-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide?
The IUPAC name of diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide (CID 11431545) is diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide.
What is the SMILES notation for diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide?
The canonical SMILES for diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide is Cc1cc(C)c(-n2cc[n+](CCP(c3ccccc3)c3ccccc3)c2)c(C)c1.[Br-].
What is the InChIKey of diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide?
The InChIKey is RHONJOMFWFUXCG-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H28N2P.BrH/c1-21-18-22(2)26(23(3)19-21)28-15-14-27(20-28)16-17-29(24-10-6-4-7-11-24)25-12-8-5-9-13-25;/h4-15,18-20H,16-17H2,1-3H3;1H/q+1;/p-1.
What are the key properties of diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide?
diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide has a molecular weight of 479.40 g/mol, XLogP of 1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]phosphane bromide is sourced from PubChem (CID 11431545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).