5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid

C8H5N3O3 — CID 114317839

IUPAC5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid
SMILESO=C(O)c1cnoc1-c1cnccn1
InChIInChI=1S/C8H5N3O3/c12-8(13)5-3-11-14-7(5)6-4-9-1-2-10-6/h1-4H,(H,12,13)
InChIKeyJMILXBNVHYPWQO-UHFFFAOYSA-N
MW191.15 g/mol
LogP0.83
Rot. Bonds2

About 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid

5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid (PubChem CID 114317839) has the molecular formula C8H5N3O3 and a molecular weight of 191.15 g/mol. Its IUPAC name is 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid
PubChem CID114317839
Molecular FormulaC8H5N3O3
Molecular Weight191.15 g/mol
Exact Mass191.03
IUPAC Name5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid
SMILESO=C(O)c1cnoc1-c1cnccn1
InChIInChI=1S/C8H5N3O3/c12-8(13)5-3-11-14-7(5)6-4-9-1-2-10-6/h1-4H,(H,12,13)
InChIKeyJMILXBNVHYPWQO-UHFFFAOYSA-N
XLogP0.83
TPSA89.11 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.15
LogP ≤ 50.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid (CID 114317839) is 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid is O=C(O)c1cnoc1-c1cnccn1.
What is the InChIKey of 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid?
The InChIKey is JMILXBNVHYPWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O3/c12-8(13)5-3-11-14-7(5)6-4-9-1-2-10-6/h1-4H,(H,12,13).
What are the key properties of 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid?
5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid has a molecular weight of 191.15 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazin-2-yl-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 114317839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).