C26H20ClN3O5 — CID 11431805
(2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[2-(2-nitrophenyl)quinolin-6-yl]propanoic acid (PubChem CID 11431805) has the molecular formula C26H20ClN3O5 and a molecular weight of 489.92 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[2-(2-nitrophenyl)quinolin-6-yl]propanoic acid.
| Compound Name | (2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[2-(2-nitrophenyl)quinolin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 11431805 |
| Molecular Formula | C26H20ClN3O5 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | (2S)-2-[(2-chloro-6-methylbenzoyl)amino]-3-[2-(2-nitrophenyl)quinolin-6-yl]propanoic acid |
| SMILES | Cc1cccc(Cl)c1C(=O)N[C@@H](Cc1ccc2nc(-c3ccccc3[N+](=O)[O-])ccc2c1)C(=O)O |
| InChI | InChI=1S/C26H20ClN3O5/c1-15-5-4-7-19(27)24(15)25(31)29-22(26(32)33)14-16-9-11-20-17(13-16)10-12-21(28-20)18-6-2-3-8-23(18)30(34)35/h2-13,22H,14H2,1H3,(H,29,31)(H,32,33)/t22-/m0/s1 |
| InChIKey | AVKQDSWLIOEMOT-QFIPXVFZSA-N |
| XLogP | 5.20 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|