C17H19ClN2O — CID 114319356
N-[[2-chloro-6-(2-pyridin-4-ylethoxy)phenyl]methyl]cyclopropanamine (PubChem CID 114319356) has the molecular formula C17H19ClN2O and a molecular weight of 302.80 g/mol. Its IUPAC name is N-[[2-chloro-6-(2-pyridin-4-ylethoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-chloro-6-(2-pyridin-4-ylethoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114319356 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[[2-chloro-6-(2-pyridin-4-ylethoxy)phenyl]methyl]cyclopropanamine |
| SMILES | Clc1cccc(OCCc2ccncc2)c1CNC1CC1 |
| InChI | InChI=1S/C17H19ClN2O/c18-16-2-1-3-17(15(16)12-20-14-4-5-14)21-11-8-13-6-9-19-10-7-13/h1-3,6-7,9-10,14,20H,4-5,8,11-12H2 |
| InChIKey | ISWHFKRZPLBROW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |