C26H50OSn — CID 11431950
[(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]-tributylstannane (PubChem CID 11431950) has the molecular formula C26H50OSn and a molecular weight of 497.40 g/mol. Its IUPAC name is [(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]-tributylstannane.
| Compound Name | [(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]-tributylstannane |
|---|---|
| PubChem CID | 11431950 |
| Molecular Formula | C26H50OSn |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | [(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C[C@H]2CC[C@H](OC(C)(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C14H23O.3C4H9.Sn/c1-13(2,3)15-12-9-8-11-7-5-6-10-14(11,12)4;3*1-3-4-2;/h7,11-12H,6,8-10H2,1-4H3;3*1,3-4H2,2H3;/t11-,12-,14-;;;;/m0..../s1 |
| InChIKey | CWZGTTUFAFLMED-QGHSGEOSSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |