C16H23ClN2O2 — CID 114319991
2-[3-chloro-2-[(2-methylpropylamino)methyl]phenoxy]-N-prop-2-enylacetamide (PubChem CID 114319991) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[3-chloro-2-[(2-methylpropylamino)methyl]phenoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[3-chloro-2-[(2-methylpropylamino)methyl]phenoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 114319991 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[3-chloro-2-[(2-methylpropylamino)methyl]phenoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1cccc(Cl)c1CNCC(C)C |
| InChI | InChI=1S/C16H23ClN2O2/c1-4-8-19-16(20)11-21-15-7-5-6-14(17)13(15)10-18-9-12(2)3/h4-7,12,18H,1,8-11H2,2-3H3,(H,19,20) |
| InChIKey | DOYZPHIOKXNECP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|