C26H52O5Si2 — CID 11432032
(2S)-2-[(2R,3aS,5R,7Z,9aS)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-2-triethylsilyloxyethanol (PubChem CID 11432032) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (2S)-2-[(2R,3aS,5R,7Z,9aS)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-2-triethylsilyloxyethanol.
| Compound Name | (2S)-2-[(2R,3aS,5R,7Z,9aS)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-2-triethylsilyloxyethanol |
|---|---|
| PubChem CID | 11432032 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (2S)-2-[(2R,3aS,5R,7Z,9aS)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-2-triethylsilyloxyethanol |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C/C=C\C[C@@H]2O[C@@H]([C@H](CO)O[Si](CC)(CC)CC)C[C@@H]2O1 |
| InChI | InChI=1S/C26H52O5Si2/c1-10-20(30-32(8,9)26(5,6)7)21-16-14-15-17-22-23(28-21)18-24(29-22)25(19-27)31-33(11-2,12-3)13-4/h14-15,20-25,27H,10-13,16-19H2,1-9H3/b15-14-/t20-,21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | MJUROFLZKIWPJI-IOEGIHHXSA-N |
| XLogP | 6.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|