C14H18Cl2O3S — CID 114320751
1-chloro-2-(chloromethyl)-3-(3-methylsulfonylcyclohexyl)oxybenzene (PubChem CID 114320751) has the molecular formula C14H18Cl2O3S and a molecular weight of 337.27 g/mol. Its IUPAC name is 1-chloro-2-(chloromethyl)-3-(3-methylsulfonylcyclohexyl)oxybenzene.
| Compound Name | 1-chloro-2-(chloromethyl)-3-(3-methylsulfonylcyclohexyl)oxybenzene |
|---|---|
| PubChem CID | 114320751 |
| Molecular Formula | C14H18Cl2O3S |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-chloro-2-(chloromethyl)-3-(3-methylsulfonylcyclohexyl)oxybenzene |
| SMILES | CS(=O)(=O)C1CCCC(Oc2cccc(Cl)c2CCl)C1 |
| InChI | InChI=1S/C14H18Cl2O3S/c1-20(17,18)11-5-2-4-10(8-11)19-14-7-3-6-13(16)12(14)9-15/h3,6-7,10-11H,2,4-5,8-9H2,1H3 |
| InChIKey | KXWXDLVWOLWBFL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|