C13H18Cl2O — CID 114320774
1-chloro-2-(chloromethyl)-3-(3,3-dimethylbutoxy)benzene (PubChem CID 114320774) has the molecular formula C13H18Cl2O and a molecular weight of 261.19 g/mol. Its IUPAC name is 1-chloro-2-(chloromethyl)-3-(3,3-dimethylbutoxy)benzene.
| Compound Name | 1-chloro-2-(chloromethyl)-3-(3,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 114320774 |
| Molecular Formula | C13H18Cl2O |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-chloro-2-(chloromethyl)-3-(3,3-dimethylbutoxy)benzene |
| SMILES | CC(C)(C)CCOc1cccc(Cl)c1CCl |
| InChI | InChI=1S/C13H18Cl2O/c1-13(2,3)7-8-16-12-6-4-5-11(15)10(12)9-14/h4-6H,7-9H2,1-3H3 |
| InChIKey | ITWCYOURZOJMDS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|