C12H13ClN2O2 — CID 114321413
2-[2-chloro-6-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine (PubChem CID 114321413) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-[2-chloro-6-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[2-chloro-6-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 114321413 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-[2-chloro-6-(1,2-oxazol-5-ylmethoxy)phenyl]ethanamine |
| SMILES | NCCc1c(Cl)cccc1OCc1ccno1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-11-2-1-3-12(10(11)4-6-14)16-8-9-5-7-15-17-9/h1-3,5,7H,4,6,8,14H2 |
| InChIKey | MAEGRVOJWXXFLY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |