C34H41NO3 — CID 11432242
(1S,2S,4aR,4bS,10aR)-4b,8,8,10a-tetramethyl-2'-oxo-N-(4-phenylphenyl)spiro[2,3,4,4a,5,8a,9,10-octahydrophenanthrene-1,4'-oxolane]-2-carboxamide (PubChem CID 11432242) has the molecular formula C34H41NO3 and a molecular weight of 511.71 g/mol. Its IUPAC name is (1S,2S,4aR,4bS,10aR)-4b,8,8,10a-tetramethyl-2'-oxo-N-(4-phenylphenyl)spiro[2,3,4,4a,5,8a,9,10-octahydrophenanthrene-1,4'-oxolane]-2-carboxamide.
| Compound Name | (1S,2S,4aR,4bS,10aR)-4b,8,8,10a-tetramethyl-2'-oxo-N-(4-phenylphenyl)spiro[2,3,4,4a,5,8a,9,10-octahydrophenanthrene-1,4'-oxolane]-2-carboxamide |
|---|---|
| PubChem CID | 11432242 |
| Molecular Formula | C34H41NO3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (1S,2S,4aR,4bS,10aR)-4b,8,8,10a-tetramethyl-2'-oxo-N-(4-phenylphenyl)spiro[2,3,4,4a,5,8a,9,10-octahydrophenanthrene-1,4'-oxolane]-2-carboxamide |
| SMILES | CC1(C)C=CC[C@@]2(C)C1CC[C@]1(C)[C@@H]2CC[C@H](C(=O)Nc2ccc(-c3ccccc3)cc2)[C@]12COC(=O)C2 |
| InChI | InChI=1S/C34H41NO3/c1-31(2)18-8-19-32(3)27(31)17-20-33(4)28(32)16-15-26(34(33)21-29(36)38-22-34)30(37)35-25-13-11-24(12-14-25)23-9-6-5-7-10-23/h5-14,18,26-28H,15-17,19-22H2,1-4H3,(H,35,37)/t26-,27?,28-,32+,33-,34+/m1/s1 |
| InChIKey | BLPUGLVXJXCLNF-KOVZPYKMSA-N |
| XLogP | 7.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|