C29H42O8 — CID 11432351
[(2R,3R)-2-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-acetyloxy-6-(acetyloxymethyl)-4-methylocta-2,4-dienoate (PubChem CID 11432351) has the molecular formula C29H42O8 and a molecular weight of 518.65 g/mol. Its IUPAC name is [(2R,3R)-2-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-acetyloxy-6-(acetyloxymethyl)-4-methylocta-2,4-dienoate.
| Compound Name | [(2R,3R)-2-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-acetyloxy-6-(acetyloxymethyl)-4-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 11432351 |
| Molecular Formula | C29H42O8 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [(2R,3R)-2-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-acetyloxy-6-(acetyloxymethyl)-4-methylocta-2,4-dienoate |
| SMILES | C/C=C(\C)C[C@H](C)C[C@H](C)[C@H]1OC(=O)C=C[C@H]1OC(=O)/C=C/C(C)=C/[C@H](CCOC(C)=O)COC(C)=O |
| InChI | InChI=1S/C29H42O8/c1-8-19(2)15-21(4)16-22(5)29-26(10-12-28(33)37-29)36-27(32)11-9-20(3)17-25(18-35-24(7)31)13-14-34-23(6)30/h8-12,17,21-22,25-26,29H,13-16,18H2,1-7H3/b11-9+,19-8+,20-17+/t21-,22-,25-,26+,29+/m0/s1 |
| InChIKey | XLBSTRNLNMLQMY-VEGBPDQMSA-N |
| XLogP | 5.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|