C28H42O7Si — CID 11432358
(1S,2R,6S,10R,11S,12S,13S)-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one (PubChem CID 11432358) has the molecular formula C28H42O7Si and a molecular weight of 518.72 g/mol. Its IUPAC name is (1S,2R,6S,10R,11S,12S,13S)-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one.
| Compound Name | (1S,2R,6S,10R,11S,12S,13S)-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one |
|---|---|
| PubChem CID | 11432358 |
| Molecular Formula | C28H42O7Si |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (1S,2R,6S,10R,11S,12S,13S)-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3C[C@H]4OC(=O)C[C@]2(O1)[C@H]4[C@@H](COCc1ccccc1)[C@@H]3COCOCC[Si](C)(C)C |
| InChI | InChI=1S/C28H42O7Si/c1-27(2)34-26-20-13-23-25(28(26,35-27)14-24(29)33-23)22(17-31-15-19-9-7-6-8-10-19)21(20)16-32-18-30-11-12-36(3,4)5/h6-10,20-23,25-26H,11-18H2,1-5H3/t20-,21+,22-,23+,25-,26+,28-/m0/s1 |
| InChIKey | FTPABDIJEGEQPE-SZHJZSLISA-N |
| XLogP | 4.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|