C15H21N3O3 — CID 114325267
2-[[(1-methylcyclohexyl)carbamoylamino]methyl]pyridine-4-carboxylic acid (PubChem CID 114325267) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[[(1-methylcyclohexyl)carbamoylamino]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[(1-methylcyclohexyl)carbamoylamino]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114325267 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[[(1-methylcyclohexyl)carbamoylamino]methyl]pyridine-4-carboxylic acid |
| SMILES | CC1(NC(=O)NCc2cc(C(=O)O)ccn2)CCCCC1 |
| InChI | InChI=1S/C15H21N3O3/c1-15(6-3-2-4-7-15)18-14(21)17-10-12-9-11(13(19)20)5-8-16-12/h5,8-9H,2-4,6-7,10H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | PGLLUVFEZYOEPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |