C19H20N6O2S — CID 1143263
N'-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2-phenylacetohydrazide (PubChem CID 1143263) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is N'-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2-phenylacetohydrazide.
| Compound Name | N'-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 1143263 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N'-[2-[(4-ethyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-2-phenylacetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)Cc2ccccc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C19H20N6O2S/c1-2-25-18(15-8-10-20-11-9-15)23-24-19(25)28-13-17(27)22-21-16(26)12-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | BORSGCPBWKHIRA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|