C18H22N2 — CID 114327187
N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,3,5-trimethylaniline (PubChem CID 114327187) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,3,5-trimethylaniline.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,3,5-trimethylaniline |
|---|---|
| PubChem CID | 114327187 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-N,3,5-trimethylaniline |
| SMILES | Cc1cc(C)cc(N(C)Cc2cccc3c2NCC3)c1 |
| InChI | InChI=1S/C18H22N2/c1-13-9-14(2)11-17(10-13)20(3)12-16-6-4-5-15-7-8-19-18(15)16/h4-6,9-11,19H,7-8,12H2,1-3H3 |
| InChIKey | BUYKURAKOAHLCI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |