C16H19F3O12S2 — CID 11432772
[(2S,3S,4R,5R,6R)-6-methoxy-2-methyl-4,5-disulfooxyoxan-3-yl] 2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 11432772) has the molecular formula C16H19F3O12S2 and a molecular weight of 524.44 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-6-methoxy-2-methyl-4,5-disulfooxyoxan-3-yl] 2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-6-methoxy-2-methyl-4,5-disulfooxyoxan-3-yl] 2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 11432772 |
| Molecular Formula | C16H19F3O12S2 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-6-methoxy-2-methyl-4,5-disulfooxyoxan-3-yl] 2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | CO[C@@H]1O[C@@H](C)[C@H](OC(=O)Cc2ccc(C(F)(F)F)cc2)[C@@H](OS(=O)(=O)O)[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C16H19F3O12S2/c1-8-12(29-11(20)7-9-3-5-10(6-4-9)16(17,18)19)13(30-32(21,22)23)14(15(27-2)28-8)31-33(24,25)26/h3-6,8,12-15H,7H2,1-2H3,(H,21,22,23)(H,24,25,26)/t8-,12-,13+,14+,15+/m0/s1 |
| InChIKey | HJYBQRLYPCYANU-VRCFELQOSA-N |
| XLogP | 0.93 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|