C11H21BrN2O — CID 114328609
2-bromo-N,2-dimethyl-N-(1-methylpiperidin-3-yl)propanamide (PubChem CID 114328609) has the molecular formula C11H21BrN2O and a molecular weight of 277.21 g/mol. Its IUPAC name is 2-bromo-N,2-dimethyl-N-(1-methylpiperidin-3-yl)propanamide.
| Compound Name | 2-bromo-N,2-dimethyl-N-(1-methylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 114328609 |
| Molecular Formula | C11H21BrN2O |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-bromo-N,2-dimethyl-N-(1-methylpiperidin-3-yl)propanamide |
| SMILES | CN1CCCC(N(C)C(=O)C(C)(C)Br)C1 |
| InChI | InChI=1S/C11H21BrN2O/c1-11(2,12)10(15)14(4)9-6-5-7-13(3)8-9/h9H,5-8H2,1-4H3 |
| InChIKey | RUWFSBLLRNWIML-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|