C13H24BrNO — CID 114328747
2-bromo-2-methyl-N-[2-(4-methylcyclohexyl)ethyl]propanamide (PubChem CID 114328747) has the molecular formula C13H24BrNO and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-bromo-2-methyl-N-[2-(4-methylcyclohexyl)ethyl]propanamide.
| Compound Name | 2-bromo-2-methyl-N-[2-(4-methylcyclohexyl)ethyl]propanamide |
|---|---|
| PubChem CID | 114328747 |
| Molecular Formula | C13H24BrNO |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-bromo-2-methyl-N-[2-(4-methylcyclohexyl)ethyl]propanamide |
| SMILES | CC1CCC(CCNC(=O)C(C)(C)Br)CC1 |
| InChI | InChI=1S/C13H24BrNO/c1-10-4-6-11(7-5-10)8-9-15-12(16)13(2,3)14/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | PHNLAJUNVTZBJZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|