C11H20BrNO2 — CID 114328802
2-bromo-N-[(1-hydroxycyclohexyl)methyl]-2-methylpropanamide (PubChem CID 114328802) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-bromo-N-[(1-hydroxycyclohexyl)methyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[(1-hydroxycyclohexyl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 114328802 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-bromo-N-[(1-hydroxycyclohexyl)methyl]-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C11H20BrNO2/c1-10(2,12)9(14)13-8-11(15)6-4-3-5-7-11/h15H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | HACARIUAEZFKCB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|