C14H13BrN2O — CID 114329651
(4-amino-3-pyridinyl)-(4-bromo-3,5-dimethylphenyl)methanone (PubChem CID 114329651) has the molecular formula C14H13BrN2O and a molecular weight of 305.18 g/mol. Its IUPAC name is (4-amino-3-pyridinyl)-(4-bromo-3,5-dimethylphenyl)methanone.
| Compound Name | (4-amino-3-pyridinyl)-(4-bromo-3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 114329651 |
| Molecular Formula | C14H13BrN2O |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (4-amino-3-pyridinyl)-(4-bromo-3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C(=O)c2cnccc2N)cc(C)c1Br |
| InChI | InChI=1S/C14H13BrN2O/c1-8-5-10(6-9(2)13(8)15)14(18)11-7-17-4-3-12(11)16/h3-7H,1-2H3,(H2,16,17) |
| InChIKey | SPUAKDOCHUKQNI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |