C16H24BrNO — CID 114330407
1-(4-bromo-3,5-dimethylphenyl)-N-methyl-2-(oxan-4-yl)ethanamine (PubChem CID 114330407) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-N-methyl-2-(oxan-4-yl)ethanamine.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-N-methyl-2-(oxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 114330407 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-N-methyl-2-(oxan-4-yl)ethanamine |
| SMILES | CNC(CC1CCOCC1)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C16H24BrNO/c1-11-8-14(9-12(2)16(11)17)15(18-3)10-13-4-6-19-7-5-13/h8-9,13,15,18H,4-7,10H2,1-3H3 |
| InChIKey | IMWMKQMSYHNGOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |