About bis(tetrabutylazanium);sulfate
bis(tetrabutylazanium);sulfate (PubChem CID 11433187) has the molecular formula C32H72N2O4S
and a molecular weight of 581.01 g/mol. Its IUPAC name is bis(tetrabutylazanium);sulfate.
Molecular Properties
| Compound Name | bis(tetrabutylazanium);sulfate |
| PubChem CID | 11433187 |
| Molecular Formula | C32H72N2O4S |
| Molecular Weight | 581.01 g/mol |
| Exact Mass | 580.52 |
| IUPAC Name | bis(tetrabutylazanium);sulfate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C16H36N.H2O4S/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h2*5-16H2,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | ZXUCBXRTRRIBSO-UHFFFAOYSA-L |
| XLogP | 8.67 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.01 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(tetrabutylazanium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tetrabutylazanium);sulfate?
The IUPAC name of bis(tetrabutylazanium);sulfate (CID 11433187) is bis(tetrabutylazanium);sulfate.
What is the SMILES notation for bis(tetrabutylazanium);sulfate?
The canonical SMILES for bis(tetrabutylazanium);sulfate is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])[O-].
What is the InChIKey of bis(tetrabutylazanium);sulfate?
The InChIKey is ZXUCBXRTRRIBSO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H36N.H2O4S/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h2*5-16H2,1-4H3;(H2,1,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(tetrabutylazanium);sulfate?
bis(tetrabutylazanium);sulfate has a molecular weight of 581.01 g/mol, XLogP of 8.67, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tetrabutylazanium);sulfate is sourced from PubChem (CID 11433187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).