C12H16N2O3 — CID 114332340
4-hydroxy-N-[(2-hydroxyphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 114332340) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-hydroxy-N-[(2-hydroxyphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[(2-hydroxyphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 114332340 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-hydroxy-N-[(2-hydroxyphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1O)C1CC(O)CN1 |
| InChI | InChI=1S/C12H16N2O3/c15-9-5-10(13-7-9)12(17)14-6-8-3-1-2-4-11(8)16/h1-4,9-10,13,15-16H,5-7H2,(H,14,17) |
| InChIKey | MERONCXRGSYJNI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|