C30H56O9Si — CID 11433272
methyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R,4R,5S,10R)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,10-trihydroxy-5-methyldec-8-enyl]oxan-2-yl]acetate (PubChem CID 11433272) has the molecular formula C30H56O9Si and a molecular weight of 588.86 g/mol. Its IUPAC name is methyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R,4R,5S,10R)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,10-trihydroxy-5-methyldec-8-enyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R,4R,5S,10R)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,10-trihydroxy-5-methyldec-8-enyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 11433272 |
| Molecular Formula | C30H56O9Si |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | methyl 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E,2R,4R,5S,10R)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4,10-trihydroxy-5-methyldec-8-enyl]oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C[C@H](O)C[C@@H](O)[C@@H](C)CC/C=C/[C@@H](O)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C30H56O9Si/c1-20(12-10-11-13-25(32)27-19-36-30(5,6)38-27)26(33)15-21(31)14-22-16-24(39-40(8,9)29(2,3)4)17-23(37-22)18-28(34)35-7/h11,13,20-27,31-33H,10,12,14-19H2,1-9H3/b13-11+/t20-,21-,22+,23+,24+,25+,26+,27+/m0/s1 |
| InChIKey | IUXSDXGKAFNVTI-JCNYGDBYSA-N |
| XLogP | 4.47 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|