C36H39FN2O5 — CID 11433376
2-[1-[3-[3-(4-fluorobenzoyl)-1,7-dipropylindol-6-yl]oxypropyl]indol-4-yl]oxy-2-methylpropanoic acid (PubChem CID 11433376) has the molecular formula C36H39FN2O5 and a molecular weight of 598.72 g/mol. Its IUPAC name is 2-[1-[3-[3-(4-fluorobenzoyl)-1,7-dipropylindol-6-yl]oxypropyl]indol-4-yl]oxy-2-methylpropanoic acid.
| Compound Name | 2-[1-[3-[3-(4-fluorobenzoyl)-1,7-dipropylindol-6-yl]oxypropyl]indol-4-yl]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11433376 |
| Molecular Formula | C36H39FN2O5 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 2-[1-[3-[3-(4-fluorobenzoyl)-1,7-dipropylindol-6-yl]oxypropyl]indol-4-yl]oxy-2-methylpropanoic acid |
| SMILES | CCCc1c(OCCCn2ccc3c(OC(C)(C)C(=O)O)cccc32)ccc2c(C(=O)c3ccc(F)cc3)cn(CCC)c12 |
| InChI | InChI=1S/C36H39FN2O5/c1-5-9-28-31(17-16-26-29(23-39(19-6-2)33(26)28)34(40)24-12-14-25(37)15-13-24)43-22-8-20-38-21-18-27-30(38)10-7-11-32(27)44-36(3,4)35(41)42/h7,10-18,21,23H,5-6,8-9,19-20,22H2,1-4H3,(H,41,42) |
| InChIKey | FWTKLIQZNXRELT-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|