C14H21Cl2N — CID 114334733
1,3-dichloro-2-methyl-N-(4-phenylbutyl)propan-2-amine (PubChem CID 114334733) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is 1,3-dichloro-2-methyl-N-(4-phenylbutyl)propan-2-amine.
| Compound Name | 1,3-dichloro-2-methyl-N-(4-phenylbutyl)propan-2-amine |
|---|---|
| PubChem CID | 114334733 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1,3-dichloro-2-methyl-N-(4-phenylbutyl)propan-2-amine |
| SMILES | CC(CCl)(CCl)NCCCCc1ccccc1 |
| InChI | InChI=1S/C14H21Cl2N/c1-14(11-15,12-16)17-10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,17H,5-6,9-12H2,1H3 |
| InChIKey | XQFLQLIFVRJDQW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|