C33H41Cl2N3O2S — CID 11433502
(3-butoxythiophen-2-yl)-[4-[(3R)-4-[(1S)-1-[4-(3,5-dichlorophenyl)phenyl]ethyl]-3-methylpiperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 11433502) has the molecular formula C33H41Cl2N3O2S and a molecular weight of 614.68 g/mol. Its IUPAC name is (3-butoxythiophen-2-yl)-[4-[(3R)-4-[(1S)-1-[4-(3,5-dichlorophenyl)phenyl]ethyl]-3-methylpiperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | (3-butoxythiophen-2-yl)-[4-[(3R)-4-[(1S)-1-[4-(3,5-dichlorophenyl)phenyl]ethyl]-3-methylpiperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 11433502 |
| Molecular Formula | C33H41Cl2N3O2S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | (3-butoxythiophen-2-yl)-[4-[(3R)-4-[(1S)-1-[4-(3,5-dichlorophenyl)phenyl]ethyl]-3-methylpiperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | CCCCOc1ccsc1C(=O)N1CCC(N2CCN([C@@H](C)c3ccc(-c4cc(Cl)cc(Cl)c4)cc3)[C@H](C)C2)CC1 |
| InChI | InChI=1S/C33H41Cl2N3O2S/c1-4-5-17-40-31-12-18-41-32(31)33(39)36-13-10-30(11-14-36)37-15-16-38(23(2)22-37)24(3)25-6-8-26(9-7-25)27-19-28(34)21-29(35)20-27/h6-9,12,18-21,23-24,30H,4-5,10-11,13-17,22H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | BKDGOSDTGPSVCJ-RPWUZVMVSA-N |
| XLogP | 8.27 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|