C11H14ClN3O3 — CID 114335425
2-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]oxyacetic acid (PubChem CID 114335425) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 114335425 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]oxyacetic acid |
| SMILES | O=C(O)COC1CCN(c2cncc(Cl)n2)CC1 |
| InChI | InChI=1S/C11H14ClN3O3/c12-9-5-13-6-10(14-9)15-3-1-8(2-4-15)18-7-11(16)17/h5-6,8H,1-4,7H2,(H,16,17) |
| InChIKey | QYGDGAILKOFICP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |