C14H19NO2 — CID 114336708
1-(2-ethoxyethyl)-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 114336708) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 1-(2-ethoxyethyl)-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 114336708 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(2-ethoxyethyl)-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | CCOCCN1CCCC(=O)c2ccccc21 |
| InChI | InChI=1S/C14H19NO2/c1-2-17-11-10-15-9-5-8-14(16)12-6-3-4-7-13(12)15/h3-4,6-7H,2,5,8-11H2,1H3 |
| InChIKey | ASVGKNJGRSKAPZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|