C12H23NO — CID 114338080
1-(1-but-3-en-2-ylpiperidin-2-yl)propan-2-ol (PubChem CID 114338080) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-(1-but-3-en-2-ylpiperidin-2-yl)propan-2-ol.
| Compound Name | 1-(1-but-3-en-2-ylpiperidin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 114338080 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-(1-but-3-en-2-ylpiperidin-2-yl)propan-2-ol |
| SMILES | C=CC(C)N1CCCCC1CC(C)O |
| InChI | InChI=1S/C12H23NO/c1-4-10(2)13-8-6-5-7-12(13)9-11(3)14/h4,10-12,14H,1,5-9H2,2-3H3 |
| InChIKey | PNAMIYVJOUGDNJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|