About 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine
2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine (PubChem CID 114340565) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine |
| PubChem CID | 114340565 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine |
| SMILES | CC1(C)CCC(OC(CN)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H29NO/c1-13(2,3)12(10-15)16-11-6-8-14(4,5)9-7-11/h11-12H,6-10,15H2,1-5H3 |
| InChIKey | RUPXVADRPCPYOS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine?
The IUPAC name of 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine (CID 114340565) is 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine.
What is the SMILES notation for 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine?
The canonical SMILES for 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine is CC1(C)CCC(OC(CN)C(C)(C)C)CC1.
What is the InChIKey of 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine?
The InChIKey is RUPXVADRPCPYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-13(2,3)12(10-15)16-11-6-8-14(4,5)9-7-11/h11-12H,6-10,15H2,1-5H3.
What are the key properties of 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine?
2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine has a molecular weight of 227.39 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcyclohexyl)oxy-3,3-dimethylbutan-1-amine is sourced from PubChem (CID 114340565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).