C16H23ClN2O2 — CID 114340622
N-(3-amino-4-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyacetamide (PubChem CID 114340622) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyacetamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyacetamide |
|---|---|
| PubChem CID | 114340622 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-(4,4-dimethylcyclohexyl)oxyacetamide |
| SMILES | CC1(C)CCC(OCC(=O)Nc2ccc(Cl)c(N)c2)CC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-16(2)7-5-12(6-8-16)21-10-15(20)19-11-3-4-13(17)14(18)9-11/h3-4,9,12H,5-8,10,18H2,1-2H3,(H,19,20) |
| InChIKey | UYXZCRGDOVKSEM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|