About 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine
8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine (PubChem CID 114340628) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine.
Molecular Properties
| Compound Name | 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine |
| PubChem CID | 114340628 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine |
| SMILES | CC1(C)CCC(OCc2ccc(N)c3cccnc23)CC1 |
| InChI | InChI=1S/C18H24N2O/c1-18(2)9-7-14(8-10-18)21-12-13-5-6-16(19)15-4-3-11-20-17(13)15/h3-6,11,14H,7-10,12,19H2,1-2H3 |
| InChIKey | RWDSNURPWYSPNO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine?
The IUPAC name of 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine (CID 114340628) is 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine.
What is the SMILES notation for 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine?
The canonical SMILES for 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine is CC1(C)CCC(OCc2ccc(N)c3cccnc23)CC1.
What is the InChIKey of 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine?
The InChIKey is RWDSNURPWYSPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O/c1-18(2)9-7-14(8-10-18)21-12-13-5-6-16(19)15-4-3-11-20-17(13)15/h3-6,11,14H,7-10,12,19H2,1-2H3.
What are the key properties of 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine?
8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine has a molecular weight of 284.40 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(4,4-dimethylcyclohexyl)oxymethyl]quinolin-5-amine is sourced from PubChem (CID 114340628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).