C16H33NO — CID 114340871
1-(4,4-dimethylcyclohexyl)oxy-N-propylpentan-2-amine (PubChem CID 114340871) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)oxy-N-propylpentan-2-amine.
| Compound Name | 1-(4,4-dimethylcyclohexyl)oxy-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 114340871 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)oxy-N-propylpentan-2-amine |
| SMILES | CCCNC(CCC)COC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H33NO/c1-5-7-14(17-12-6-2)13-18-15-8-10-16(3,4)11-9-15/h14-15,17H,5-13H2,1-4H3 |
| InChIKey | KNXLVOWOHPQOAX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |