C16H21NO4 — CID 114341232
1-[5-(4,4-dimethylcyclohexyl)oxy-2-nitrophenyl]ethanone (PubChem CID 114341232) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[5-(4,4-dimethylcyclohexyl)oxy-2-nitrophenyl]ethanone.
| Compound Name | 1-[5-(4,4-dimethylcyclohexyl)oxy-2-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 114341232 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-[5-(4,4-dimethylcyclohexyl)oxy-2-nitrophenyl]ethanone |
| SMILES | CC(=O)c1cc(OC2CCC(C)(C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21NO4/c1-11(18)14-10-13(4-5-15(14)17(19)20)21-12-6-8-16(2,3)9-7-12/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | WSQKZDQXBVZEAY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|