C14H21ClN2O — CID 114341774
5-(chloromethyl)-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyrimidine (PubChem CID 114341774) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyrimidine.
| Compound Name | 5-(chloromethyl)-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyrimidine |
|---|---|
| PubChem CID | 114341774 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 5-(chloromethyl)-2-(4,4-dimethylcyclohexyl)oxy-4-methylpyrimidine |
| SMILES | Cc1nc(OC2CCC(C)(C)CC2)ncc1CCl |
| InChI | InChI=1S/C14H21ClN2O/c1-10-11(8-15)9-16-13(17-10)18-12-4-6-14(2,3)7-5-12/h9,12H,4-8H2,1-3H3 |
| InChIKey | PZIUDPYJBLQWKG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|