About [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol
[2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol (PubChem CID 114342766) has the molecular formula C18H35NO2
and a molecular weight of 297.48 g/mol. Its IUPAC name is [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol |
| PubChem CID | 114342766 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol |
| SMILES | CCNC1(CO)CCCC1CCOC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H35NO2/c1-4-19-18(14-20)10-5-6-15(18)9-13-21-16-7-11-17(2,3)12-8-16/h15-16,19-20H,4-14H2,1-3H3 |
| InChIKey | RUNMCCPQUWZHOW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol?
The IUPAC name of [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol (CID 114342766) is [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol.
What is the SMILES notation for [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol?
The canonical SMILES for [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol is CCNC1(CO)CCCC1CCOC1CCC(C)(C)CC1.
What is the InChIKey of [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol?
The InChIKey is RUNMCCPQUWZHOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO2/c1-4-19-18(14-20)10-5-6-15(18)9-13-21-16-7-11-17(2,3)12-8-16/h15-16,19-20H,4-14H2,1-3H3.
What are the key properties of [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol?
[2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol has a molecular weight of 297.48 g/mol, XLogP of 3.50, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(4,4-dimethylcyclohexyl)oxyethyl]-1-(ethylamino)cyclopentyl]methanol is sourced from PubChem (CID 114342766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).