C15H19NO5 — CID 114343273
1-[(2,3-dihydroxybenzoyl)amino]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 114343273) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-[(2,3-dihydroxybenzoyl)amino]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(2,3-dihydroxybenzoyl)amino]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114343273 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 1-[(2,3-dihydroxybenzoyl)amino]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(NC(=O)c2cccc(O)c2O)(C(=O)O)CC1 |
| InChI | InChI=1S/C15H19NO5/c1-9-5-7-15(8-6-9,14(20)21)16-13(19)10-3-2-4-11(17)12(10)18/h2-4,9,17-18H,5-8H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | HEIKHVFGGHWGJE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|