C12H16N2O3 — CID 114343480
2,3-dihydroxy-N-piperidin-3-ylbenzamide (PubChem CID 114343480) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2,3-dihydroxy-N-piperidin-3-ylbenzamide.
| Compound Name | 2,3-dihydroxy-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 114343480 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2,3-dihydroxy-N-piperidin-3-ylbenzamide |
| SMILES | O=C(NC1CCCNC1)c1cccc(O)c1O |
| InChI | InChI=1S/C12H16N2O3/c15-10-5-1-4-9(11(10)16)12(17)14-8-3-2-6-13-7-8/h1,4-5,8,13,15-16H,2-3,6-7H2,(H,14,17) |
| InChIKey | RHPVREOEZDLABN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|