C14H17NO5 — CID 114343728
methyl 1-(2,3-dihydroxybenzoyl)piperidine-4-carboxylate (PubChem CID 114343728) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 1-(2,3-dihydroxybenzoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(2,3-dihydroxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 114343728 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 1-(2,3-dihydroxybenzoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2cccc(O)c2O)CC1 |
| InChI | InChI=1S/C14H17NO5/c1-20-14(19)9-5-7-15(8-6-9)13(18)10-3-2-4-11(16)12(10)17/h2-4,9,16-17H,5-8H2,1H3 |
| InChIKey | YCTWJVPDTSVCBL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|